Home
>
Chemical Reagents>Organometallic Reagents> (S)-3-(4-Boronophenyl)-2-((tert-butoxycarbonyl)amino)propanoic acid
For research use only. Not for therapeutic Use.
(S)-3-(4-Boronophenyl)-2-((start-butoxy carbonyl)amino)propanoic acid(Cat No.:L006736), is a chiral compound used in chemical research and synthesis. it consists of a boronophenyl group, a protected amino group (tert-butoxycarbonyl), and a propanoic acid moiety. This compound is essential in the development of pharmaceuticals and advanced materials due to its unique structure. It serves as a key intermediate in organic synthesis, enabling the creation of complex molecules. Researchers utilize it in the production of drug candidates, allowing for the exploration of new therapeutic agents and advancements in the field of medicinal chemistry.
CAS Number | 119771-23-2 |
Molecular Formula | C14H20BNO6 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | (2S)-3-(4-boronophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
InChI | InChI=1S/C14H20BNO6/c1-14(2,3)22-13(19)16-11(12(17)18)8-9-4-6-10(7-5-9)15(20)21/h4-7,11,20-21H,8H2,1-3H3,(H,16,19)(H,17,18)/t11-/m0/s1 |
InChIKey | SGRRXMOSJYUMBY-NSHDSACASA-N |
SMILES | B(C1=CC=C(C=C1)CC(C(=O)O)NC(=O)OC(C)(C)C)(O)O |