Home
>
Chemical Reagents> (S)-3-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-4-(3-(trifluoromethyl)phenyl)butanoic acid
For research use only. Not for therapeutic Use.
(S)-3-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-4-(3-(trifluoromethyl)phenyl)butanoic acid(Cat No.:L006853), is a complex organic compound used in medicinal chemistry and drug development. Its structure features a fluorenyl methoxy carbonyl group, a trifluoromethylphenyl group, and a butanoic acid moiety. Scientists utilize this compound as a key intermediate in the synthesis of pharmaceuticals, particularly in the development of targeted therapies. The specific arrangement of functional groups provides opportunities for diverse chemical modifications, enabling the creation of potential drug candidates.
CAS Number | 270065-78-6 |
Molecular Formula | C26H22F3NO4 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[3-(trifluoromethyl)phenyl]butanoic acid |
InChI | InChI=1S/C26H22F3NO4/c27-26(28,29)17-7-5-6-16(12-17)13-18(14-24(31)32)30-25(33)34-15-23-21-10-3-1-8-19(21)20-9-2-4-11-22(20)23/h1-12,18,23H,13-15H2,(H,30,33)(H,31,32)/t18-/m0/s1 |
InChIKey | SHSVTUCIAQWRSI-SFHVURJKSA-N |
SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC4=CC(=CC=C4)C(F)(F)F)CC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |