For research use only. Not for therapeutic Use.
(S)-3-Phenyl-2-[(pyrazin-2-ylcarbonyl)amino]propanoic acid (Cat.No:M020990) is a chemical compound with potential pharmaceutical applications. It exhibits a unique structure and may possess bioactive properties. Further research is needed to understand its specific characteristics, potential therapeutic uses, and relevance in drug discovery and development.
CAS Number | 114457-94-2 |
Molecular Formula | C14H13N3O3 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | (2S)-3-phenyl-2-(pyrazine-2-carbonylamino)propanoic acid |
InChI | InChI=1S/C14H13N3O3/c18-13(12-9-15-6-7-16-12)17-11(14(19)20)8-10-4-2-1-3-5-10/h1-7,9,11H,8H2,(H,17,18)(H,19,20)/t11-/m0/s1 |
InChIKey | DWYZPDHMMZGQAP-NSHDSACASA-N |
SMILES | C1=CC=C(C=C1)CC(C(=O)O)NC(=O)C2=NC=CN=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |