Home
>
Catalysts and Ligands>Chiral phosphine ligands>
>
(S)-3-(tert-butyl)-4-(2,6-dimethoxy-3,5-dimethylphenyl)-2,3-dihydrobenzo[d][1,3]oxaphosphole
For research use only. Not for therapeutic Use.
(S)-3-(tert-butyl)-4-(2,6-dimethoxy-3,5-dimethylphenyl)-2,3-dihydrobenzo[d][1,3]oxaphosphole (Cat.No:L004007) is a significant compound in organic synthesis. Its unique structure, featuring a dihydrobenzo[d][1,3]oxaphosphole and dimethoxyphenyl group, imparts specialized reactivity. This compound serves as a valuable building block in the creation of specialized molecules with potential applications in pharmaceutical and chemical research.
Catalog Number | L004007 |
CAS Number | 2021202-03-7 |
Molecular Formula | C21H27O3P |
Purity | ≥95% |
IUPAC Name | (3S)-3-tert-butyl-4-(2,6-dimethoxy-3,5-dimethylphenyl)-2H-1,3-benzoxaphosphole |
InChI | InChI=1S/C21H27O3P/c1-13-11-14(2)19(23-7)17(18(13)22-6)15-9-8-10-16-20(15)25(12-24-16)21(3,4)5/h8-11H,12H2,1-7H3/t25-/m1/s1 |
InChIKey | HEETVIXTAXQITH-RUZDIDTESA-N |
SMILES | CC1=CC(=C(C(=C1OC)C2=C3C(=CC=C2)OC[P@]3C(C)(C)C)OC)C |