Home
>
Catalysts and Ligands>Chiral phosphine ligands>
>
(S)-3-(tert-Butyl)-4-(3,5-diisopropyl-2,6-dimethoxyphenyl)-2,3-dihydrobenzo[d][1,3]oxaphosphole
For research use only. Not for therapeutic Use.
(S)-3-(tert-Butyl)-4-(3,5-diisopropyl-2,6-dimethoxyphenyl)-2,3-dihydrobenzo[d][1,3]oxaphosphole (Cat.No:L003801) is a significant compound in organic synthesis. Its unique structure combines a dihydrobenzoxaphosphole motif with bulky substituents, allowing for diverse reactivity and applications. This compound serves as a crucial building block in the preparation of specialized organic molecules with various industrial and pharmaceutical uses.
Catalog Number | L003801 |
CAS Number | 2444702-33-2 |
Molecular Formula | C25H35O3P |
Purity | ≥95% |
IUPAC Name | (3S)-3-tert-butyl-4-[2,6-dimethoxy-3,5-di(propan-2-yl)phenyl]-2H-1,3-benzoxaphosphole |
InChI | InChI=1S/C25H35O3P/c1-15(2)18-13-19(16(3)4)23(27-9)21(22(18)26-8)17-11-10-12-20-24(17)29(14-28-20)25(5,6)7/h10-13,15-16H,14H2,1-9H3/t29-/m1/s1 |
InChIKey | OOHKUWRYRFUFIJ-GDLZYMKVSA-N |
SMILES | CC(C)C1=CC(=C(C(=C1OC)C2=C3C(=CC=C2)OC[P@]3C(C)(C)C)OC)C(C)C |