For research use only. Not for therapeutic Use.
Competitive group I metabotropic glutamate receptor antagonist, with selectivity for mGlu<sub>1a/1a</sub> over mGlu<sub>5a/5b</sub>.
| Catalog Number | I010191 |
| CAS Number | 134052-73-6 |
| Synonyms | Alternative Name: (S)-4CPG |
| Molecular Formula | C9H9NO4 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | Soluble to 100 mM in 1eq. NaOH with gentle warming |
| Storage | Store at RT |
| IUPAC Name | 4-[(S)-amino(carboxy)methyl]benzoic acid |
| InChI | InChI=1S/C9H9NO4/c10-7(9(13)14)5-1-3-6(4-2-5)8(11)12/h1-4,7H,10H2,(H,11,12)(H,13,14)/t7-/m0/s1 |
| InChIKey | VTMJKPGFERYGJF-ZETCQYMHSA-N |
| SMILES | C1=CC(=CC=C1C(C(=O)O)N)C(=O)O |
