For research use only. Not for therapeutic Use.
(S)-4-(Hydroxymethyl)pyrrolidin-2-one(Cat No.:L007443), is a chemical compound bearing the molecular formula C₅H₉NO₂. Recognized for its chiral nature, it exists as a pyrrolidone derivative with a hydroxymethyl (-CH₂OH) group. This compound has gained significance in pharmaceutical research and development due to its role as an important chiral building block. Researchers often use it in the synthesis of various biologically active molecules, including pharmaceuticals and agrochemicals. Its chiral center enables precise control over molecular configurations, making it valuable for producing enantiomerically pure compounds, which are crucial in drug discovery and development processes.
CAS Number | 476423-84-4 |
Molecular Formula | C5H9NO2 |
Purity | ≥95% |
IUPAC Name | (4S)-4-(hydroxymethyl)pyrrolidin-2-one |
InChI | InChI=1S/C5H9NO2/c7-3-4-1-5(8)6-2-4/h4,7H,1-3H2,(H,6,8)/t4-/m0/s1 |
InChIKey | KTOFYLXSANIPND-BYPYZUCNSA-N |
SMILES | C1C(CNC1=O)CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |