Home
>
Catalysts and Ligands>Chiral nitrogen ligands> (S)-4-(tert-Butyl)-2-(quinolin-2-yl)-4,5-dihydrooxazole
For research use only. Not for therapeutic Use.
(S)-4-(tert-Butyl)-2-(quinolin-2-yl)-4,5-dihydrooxazole (Cat.No:L003330) is a significant chemical compound in pharmaceutical research. Its unique structure and biological activity make it a promising candidate for the development of novel drugs, highlighting its importance in modern medicinal chemistry.
Catalog Number | L003330 |
CAS Number | 226387-12-8 |
Molecular Formula | C16H18N2O |
Purity | ≥95% |
IUPAC Name | (4S)-4-tert-butyl-2-quinolin-2-yl-4,5-dihydro-1,3-oxazole |
InChI | InChI=1S/C16H18N2O/c1-16(2,3)14-10-19-15(18-14)13-9-8-11-6-4-5-7-12(11)17-13/h4-9,14H,10H2,1-3H3/t14-/m1/s1 |
InChIKey | ZECIAWBAXVMXKI-CQSZACIVSA-N |
SMILES | CC(C)(C)[C@H]1COC(=N1)C2=NC3=CC=CC=C3C=C2 |