For research use only. Not for therapeutic Use.
(S)-6-Bromo-2,3-dihydrobenzofuran-3-amine hydrochloride (Cat.No:L003368) is a crucial chiral compound in pharmaceutical research. Its enantiopure form exhibits potential for drug development, highlighting its importance in the pursuit of innovative pharmaceutical agents.
CAS Number | 2225878-88-4 |
Molecular Formula | C8H9BrClNO |
Purity | ≥95% |
IUPAC Name | (3S)-6-bromo-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
InChI | InChI=1S/C8H8BrNO.ClH/c9-5-1-2-6-7(10)4-11-8(6)3-5;/h1-3,7H,4,10H2;1H/t7-;/m1./s1 |
InChIKey | BTTOLFCXRXFGKD-OGFXRTJISA-N |
SMILES | C1[C@H](C2=C(O1)C=C(C=C2)Br)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |