For research use only. Not for therapeutic Use.
S-acetyl-PEG4-amine (TFA) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1].
PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1].
| Catalog Number | I042843 |
| Synonyms | S-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethyl] ethanethioate;2,2,2-trifluoroacetic acid |
| Molecular Formula | C14H26F3NO7S |
| Purity | ≥95% |
| InChI | InChI=1S/C12H25NO5S.C2HF3O2/c1-12(14)19-11-10-18-9-8-17-7-6-16-5-4-15-3-2-13;3-2(4,5)1(6)7/h2-11,13H2,1H3;(H,6,7) |
| InChIKey | WAISOMYTZOSUBK-UHFFFAOYSA-N |
| SMILES | CC(=O)SCCOCCOCCOCCOCCN.C(=O)(C(F)(F)F)O |
| Reference | [1]. Nalawansha DA, et al. PROTACs: An Emerging Therapeutic Modality in Precision Medicine. Cell Chem Biol. 2020;27(8):998-1011. |
