For research use only. Not for therapeutic Use.
S(-)-Baclofen hydrochloride (Cat.No:I012252) is the hydrochloride salt of the enantiomer S(-)-Baclofen, a medication used primarily as a muscle relaxant and antispastic agent. It acts on GABA-B receptors in the central nervous system, reducing muscle spasms and pain associated with conditions such as multiple sclerosis and spinal cord injuries.
CAS Number | 63701-56-4 |
Synonyms | S(–)-beta-(Aminomethyl)-4-chlorobenzenepropanoic acid hydrochloride |
Molecular Formula | C10H13Cl2NO2 |
Purity | ≥95% |
IUPAC Name | (3S)-4-amino-3-(4-chlorophenyl)butanoic acid;hydrochloride |
InChI | InChI=1S/C10H12ClNO2.ClH/c11-9-3-1-7(2-4-9)8(6-12)5-10(13)14;/h1-4,8H,5-6,12H2,(H,13,14);1H/t8-;/m1./s1 |
InChIKey | WMNUVYYLMCMHLU-DDWIOCJRSA-N |
SMILES | C1=CC(=CC=C1C(CC(=O)O)CN)Cl.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |