For research use only. Not for therapeutic Use.
S-Diclofenac is a hybrid molecule of an H2S donor and the NSAID diclofenac. S-Diclofenac spares the gastric mucosa of injury despite markedly suppressing prostaglandin synthesis[1].
| Catalog Number | I011703 |
| CAS Number | 912758-00-0 |
| Synonyms | [4-(5-sulfanylidenedithiol-3-yl)phenyl] 2-[2-(2,6-dichloroanilino)phenyl]acetate |
| Molecular Formula | C23H15Cl2NO2S3 |
| Purity | ≥95% |
| InChI | InChI=1S/C23H15Cl2NO2S3/c24-17-5-3-6-18(25)23(17)26-19-7-2-1-4-15(19)12-21(27)28-16-10-8-14(9-11-16)20-13-22(29)31-30-20/h1-11,13,26H,12H2 |
| InChIKey | BRDUXOHVEZVAHI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)OC2=CC=C(C=C2)C3=CC(=S)SS3)NC4=C(C=CC=C4Cl)Cl |
| Reference | [1]. Wallace JL, et al. Gastrointestinal safety and anti-inflammatory effects of a hydrogen sulfide-releasing diclofenac derivative in the rat. Gastroenterology. 2007 Jan;132(1):261-71. |
