For research use only. Not for therapeutic Use.
(S)-Ethyl 2-(piperidin-3-yl)acetate is a chiral organic compound used in pharmaceutical synthesis. Featuring a piperidine ring and an ethyl acetate group, it serves as an intermediate in the production of various medicinal agents. Its enantiomeric purity is crucial for the biological activity of the final pharmaceutical products, making it valuable in the development of drugs targeting neurological and cardiovascular conditions.
CAS Number | 188883-58-1 |
Synonyms | (3S)-3-Piperidineacetic Acid Ethyl Ester; Ethyl (3S)-3 Piperidineacetate |
Molecular Formula | C9H18ClNO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | ethyl 2-[(3S)-piperidin-3-yl]acetate;hydrochloride |
InChI | InChI=1S/C9H17NO2.ClH/c1-2-12-9(11)6-8-4-3-5-10-7-8;/h8,10H,2-7H2,1H3;1H/t8-;/m0./s1 |
InChIKey | NUFQPPPCFKZWRT-QRPNPIFTSA-N |
SMILES | CCOC(=O)CC1CCCNC1.Cl |