For research use only. Not for therapeutic Use.
(S)-Fesoterodine Fumarate is a high-purity pharmaceutical compound essential for advanced pharmacological and medicinal research. This active enantiomer of fesoterodine is crucial for studies involving muscarinic receptor antagonism, urinary incontinence treatment, and drug metabolism. Known for its stability and specific (S)-configuration, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in various scientific applications.
Catalog Number | R020174 |
CAS Number | 1431511-18-0 |
Molecular Formula | C30H41NO7 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (E)-but-2-enedioic acid;[2-[(1S)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenyl] 2-methylpropanoate |
InChI | InChI=1S/C26H37NO3.C4H4O4/c1-18(2)26(29)30-25-13-12-21(17-28)16-24(25)23(22-10-8-7-9-11-22)14-15-27(19(3)4)20(5)6;5-3(6)1-2-4(7)8/h7-13,16,18-20,23,28H,14-15,17H2,1-6H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t23-;/m0./s1 |
InChIKey | MWHXMIASLKXGBU-LASJEQTRSA-N |
SMILES | CC(C)C(=O)OC1=C(C=C(C=C1)CO)C(CCN(C(C)C)C(C)C)C2=CC=CC=C2.C(=CC(=O)O)C(=O)O |