For research use only. Not for therapeutic Use.
(S)-Gossypol acetic acid(CAT: I000679), also known as AT-101 or R-(-)-gossypol acetic acid, is a synthetic derivative of gossypol. Gossypol is a natural compound found in cottonseeds and has been studied for its potential anticancer properties. (S)-Gossypol acetic acid functions as a pan-inhibitor of Bcl-2 family proteins, which play a crucial role in regulating apoptosis (cell death) pathways. By inhibiting the anti-apoptotic proteins such as Bcl-2, Bcl-XL, and Mcl-1, (S)-Gossypol acetic acid can promote apoptosis in cancer cells, potentially inhibiting their growth and survival. It has shown promise in preclinical and clinical studies for various types of cancer and is being investigated as a potential therapeutic agent.
CAS Number | 1189561-66-7 |
Molecular Formula | C32H34O10 |
Purity | ≥95% |
Target | Bcl-2 Family |
Solubility | 10 mM in DMSO |
Storage | store at -20 ℃ |
IC50 | 18.1μM (Bcl-2), 22.9μM (Bcl-xL) |
IUPAC Name | acetic acid;7-(8-formyl-1,6,7-trihydroxy-3-methyl-5-propan-2-ylnaphthalen-2-yl)-2,3,8-trihydroxy-6-methyl-4-propan-2-ylnaphthalene-1-carbaldehyde |
InChI | 1S/C30H30O8.C2H4O2/c1-11(2)19-15-7-13(5)21(27(35)23(15)17(9-31)25(33)29(19)37)22-14(6)8-16-20(12(3)4)30(38)26(34)18(10-32)24(16)28(22)36;1-2(3)4/h7-12,33-38H,1-6H3;1H3,(H,3,4) |
InChIKey | NIOHNDKHQHVLKA-UHFFFAOYSA-N |
SMILES | CC1=CC2=C(C(=C(C(=C2C(C)C)O)O)C=O)C(=C1C3=C(C4=C(C=C3C)C(=C(C(=C4C=O)O)O)C(C)C)O)O.CC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |