For research use only. Not for therapeutic Use.
(S)-Methyl 3-cyclopropyl-2-hydroxypropanoate(CAT: L000042) is a chemical compound with importance in organic chemistry. This compound serves as a valuable building block for the synthesis of various organic compounds, enabling the diversification of chemical synthesis. Its specific structure, which includes a cyclopropyl ring and a hydroxy functional group, offers opportunities for creating specialized molecules with potential applications in different areas within the field of organic chemistry.
CAS Number | 2165755-17-7 |
Molecular Formula | C7H12O3 |
Purity | ≥95% |
IUPAC Name | methyl (2S)-3-cyclopropyl-2-hydroxypropanoate |
InChI | InChI=1S/C7H12O3/c1-10-7(9)6(8)4-5-2-3-5/h5-6,8H,2-4H2,1H3/t6-/m0/s1 |
InChIKey | VXLNSAWLGBKTEO-LURJTMIESA-N |