For research use only. Not for therapeutic Use.
S-Metolachlor(Cat No.:R069689), is a widely used herbicide in agriculture. It belongs to the chloroacetanilide class of herbicides and is known for its effectiveness in controlling grass and broadleaf weeds in various crops, including corn, soybeans, and cotton. S-metolachlor works by inhibiting weed seedlings’ shoot growth and root development, ultimately leading to their death. Its selectivity allows it to be applied over a wide range of crops without causing significant harm.
Catalog Number | R069689 |
CAS Number | 87392-12-9 |
Molecular Formula | C15H22ClNO2 |
Purity | ≥95% |
Storage | 0-6°C |
IUPAC Name | 2-chloro-N-(2-ethyl-6-methylphenyl)-N-[(2S)-1-methoxypropan-2-yl]acetamide |
InChI | InChI=1S/C15H22ClNO2/c1-5-13-8-6-7-11(2)15(13)17(14(18)9-16)12(3)10-19-4/h6-8,12H,5,9-10H2,1-4H3/t12-/m0/s1 |
InChIKey | WVQBLGZPHOPPFO-LBPRGKRZSA-N |
SMILES | CCC1=CC=CC(=C1N(C(C)COC)C(=O)CCl)C |