For research use only. Not for therapeutic Use.
(S)-MRTX-1719（Cat No.:I043458）is a selective small molecule inhibitor targeting the mutant KRAS G12C protein, which is involved in the regulation of cell growth and survival. KRAS mutations, particularly the G12C mutation, are commonly found in various cancers, including lung, colorectal, and pancreatic cancer. By specifically inhibiting the mutant form of KRAS G12C, (S)-MRTX-1719 aims to block oncogenic signaling, suppress tumor growth, and improve treatment outcomes. This compound is being investigated as a targeted therapeutic option for cancers driven by KRAS G12C mutations, offering a precision approach to cancer treatment.
| CAS Number | 2630904-44-6 |
| Synonyms | 2-[4-[4-(aminomethyl)-1-oxo-2H-phthalazin-6-yl]-2-methylpyrazol-3-yl]-4-chloro-6-cyclopropyloxy-3-fluorobenzonitrile |
| Molecular Formula | C23H18ClFN6O2 |
| Purity | ≥95% |
| IUPAC Name | 2-[4-[4-(aminomethyl)-1-oxo-2H-phthalazin-6-yl]-2-methylpyrazol-3-yl]-4-chloro-6-cyclopropyloxy-3-fluorobenzonitrile |
| InChI | InChI=1S/C23H18ClFN6O2/c1-31-22(20-15(8-26)19(33-12-3-4-12)7-17(24)21(20)25)16(10-28-31)11-2-5-13-14(6-11)18(9-27)29-30-23(13)32/h2,5-7,10,12H,3-4,9,27H2,1H3,(H,30,32) |
| InChIKey | BZKIOORWZAXIBA-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C=N1)C2=CC3=C(C=C2)C(=O)NN=C3CN)C4=C(C(=CC(=C4F)Cl)OC5CC5)C#N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
