For research use only. Not for therapeutic Use.
(S)-MRTX-1719 (example 16-7) is the S-enantiomer of MRTX-1719. (S)-MRTX-1719 is a PRMT5/MTA complex inhibitor, with an IC50 of 7070 nM[1].
| Catalog Number | I043458 |
| CAS Number | 2630904-44-6 |
| Synonyms | 2-[4-[4-(aminomethyl)-1-oxo-2H-phthalazin-6-yl]-2-methylpyrazol-3-yl]-4-chloro-6-cyclopropyloxy-3-fluorobenzonitrile |
| Molecular Formula | C23H18ClFN6O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C23H18ClFN6O2/c1-31-22(20-15(8-26)19(33-12-3-4-12)7-17(24)21(20)25)16(10-28-31)11-2-5-13-14(6-11)18(9-27)29-30-23(13)32/h2,5-7,10,12H,3-4,9,27H2,1H3,(H,30,32) |
| InChIKey | BZKIOORWZAXIBA-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C=N1)C2=CC3=C(C=C2)C(=O)NN=C3CN)C4=C(C(=CC(=C4F)Cl)OC5CC5)C#N |
| Reference | [1]. Thomas P. BOBINSKI, et al. Mta-cooperative prmt5 inhibitors. WO2021050915A1. |
