For research use only. Not for therapeutic Use.
S-[N-Benzyl(thiocarbamoyl)]-L-cysteine (Cat No.:R000038) is a chemical compound composed of L-cysteine with a thiocarbamoyl group containing a benzyl moiety attached to its nitrogen atom. This compound is used as a building block in organic synthesis and chemical reactions. It finds applications in pharmaceutical research, where it may serve as an intermediate in the preparation of organic molecules with potential biological activities. The presence of the benzyl-thiocarbamoyl group offers versatility in designing and developing novel compounds for various biomedical and chemical purposes.
CAS Number | 35446-36-7 |
Synonyms | L-Cysteine (Phenylmethyl)carbamodithioate; Uraton; |
Molecular Formula | C11H14N2O2S2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2R)-2-amino-3-(benzylcarbamothioylsulfanyl)propanoic acid |
InChI | InChI=1S/C11H14N2O2S2/c12-9(10(14)15)7-17-11(16)13-6-8-4-2-1-3-5-8/h1-5,9H,6-7,12H2,(H,13,16)(H,14,15)/t9-/m0/s1 |
InChIKey | RSTSYGXUDMJEFP-VIFPVBQESA-N |
SMILES | C1=CC=C(C=C1)CNC(=S)SCC(C(=O)O)N |