For research use only. Not for therapeutic Use.
SNAP is an S-<wbr></wbr>nitrosothiol which serves as a NO donor and a potent vasodilator. Its stability in solution varies from seconds to hours depending on temperature, buffer composition and metal content. At pH 6-<wbr></wbr>8 and 37°C, the half-<wbr></wbr>life of SNAP is approximately six hours in the presence of transition metal ion chelators.
CAS Number | 67776-06-1 |
Synonyms | SNAP; N-(Acetyl)-3-(nitrosothio)valine; |
Molecular Formula | C7H12N2O4S |
Purity | ≥95% |
Target | NO Synthase |
Storage | -20°C |
IUPAC Name | 2-acetamido-3-methyl-3-nitrososulfanylbutanoic acid |
InChI | InChI=1S/C7H12N2O4S/c1-4(10)8-5(6(11)12)7(2,3)14-9-13/h5H,1-3H3,(H,8,10)(H,11,12) |
InChIKey | ZIIQCSMRQKCOCT-UHFFFAOYSA-N |
SMILES | CC(=O)NC(C(=O)O)C(C)(C)SN=O |