For research use only. Not for therapeutic Use.
ß-pBrPh-Glc (CAT: I036656), short for β-p-bromophenyl-glucoside, is a chemical compound consisting of a glucose molecule linked to a para-bromophenyl group via a β-glycosidic bond. This type of compound is often used in biochemical research, particularly in studying glycosidase enzyme activity and carbohydrate metabolism. The para-bromophenyl group can serve as a functional handle, making the compound useful for detecting enzymatic reactions or for affinity-based assays. Additionally, it may be employed in synthetic chemistry for developing glycomimetics or as a substrate in enzymatic hydrolysis experiments. Its bromine atom further allows for potential radiolabeling or other modifications in medicinal chemistry applications.
CAS Number | 30572-42-0 |
Synonyms | (2S,3R,4S,5S,6R)-2-(4-bromophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
Molecular Formula | C12H15BrO6 |
Purity | ≥95% |
InChI | InChI=1S/C12H15BrO6/c13-6-1-3-7(4-2-6)18-12-11(17)10(16)9(15)8(5-14)19-12/h1-4,8-12,14-17H,5H2/t8-,9-,10+,11-,12-/m1/s1 |
InChIKey | XKNTYHQVRMHDHY-RMPHRYRLSA-N |
SMILES | C1=CC(=CC=C1OC2C(C(C(C(O2)CO)O)O)O)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |