For research use only. Not for therapeutic Use.
ß-PMP-Glc (Cat No.:I014690) is a modified form of glucose known as β-phenyl-1-O-methyl-α-D-glucopyranoside. It features a phenyl group at the C1 position and a methoxy group at the C4 position. ß-PMP-Glc is commonly used as a building block in organic synthesis, particularly in the creation of complex carbohydrate-based compounds. It finds applications in areas such as medicinal chemistry, chemical biology, and carbohydrate research.
| Catalog Number | I014690 |
| CAS Number | 6032-32-2 |
| Synonyms | ß-PMP-Glc; ßPMPGlc; ß PMP Glc; Beta-PMP-Glc; p-Methoxyphenyl-ß-D-glucopyranoside; p-Methoxyphenyl-Beta-D-glucopyranoside;;(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(4-methoxyphenoxy)tetrahydro-2H-pyran-3,4,5-triol |
| Molecular Formula | C13H18O7 |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| Storage | 2-8°C |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(4-methoxyphenoxy)oxane-3,4,5-triol |
| InChI | InChI=1S/C13H18O7/c1-18-7-2-4-8(5-3-7)19-13-12(17)11(16)10(15)9(6-14)20-13/h2-5,9-17H,6H2,1H3/t9-,10-,11+,12-,13-/m1/s1 |
| InChIKey | SIXFVXJMCGPTRB-UJPOAAIJSA-N |
| SMILES | COC1=CC=C(C=C1)OC2C(C(C(C(O2)CO)O)O)O |
| Reference | </br>1: Capicciotti CJ, Kurach JD, Turner TR, Mancini RS, Acker JP, Ben RN. Small molecule ice recrystallization inhibitors enable freezing of human red blood cells with reduced glycerol concentrations. Sci Rep. 2015 Apr 8;5:9692. doi: 10.1038/srep09692. PubMed PMID: 25851700; PubMed Central PMCID: PMC4389209.</br></br></br> |
