Home
>
Inhibitors/Agonists>Natural Products> (S)-Quinolin-4-yl((1S,2S,4S,5R)-5-vinylquinuclidin-2-yl)methanamine trihydrochloride
For research use only. Not for therapeutic Use.
(S)-Quinolin-4-yl((1S,2S,4S,5R)-5-vinylquinuclidin-2-yl)methanamine trihydrochloride(CAT: L005989) is a complex compound with potential applications in diverse scientific domains. Its structure, combining a quinoline ring with a quinuclidine moiety, suggests multifaceted interactions. This compound may engage with specific biological targets, making it intriguing in medicinal chemistry and drug development. Its mode of action could involve modulation of cellular processes or interactions with receptors or enzymes.
CAS Number | 1263486-03-8 |
Molecular Formula | C19H24ClN3 |
Purity | ≥95% |
IUPAC Name | (S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanamine;hydrochloride |
InChI | InChI=1S/C19H23N3.ClH/c1-2-13-12-22-10-8-14(13)11-18(22)19(20)16-7-9-21-17-6-4-3-5-15(16)17;/h2-7,9,13-14,18-19H,1,8,10-12,20H2;1H/t13-,14-,18-,19-;/m0./s1 |
InChIKey | SPUPSIIJKXMXIF-ACGXRFDVSA-N |