For research use only. Not for therapeutic Use.
(S)-Salmeterol(Cat No.:M115606) is a chiral selective form of salmeterol, a long-acting beta-2 adrenergic receptor agonist used primarily for the treatment of asthma and chronic obstructive pulmonary disease (COPD). It works by binding to beta-2 receptors in the airway smooth muscle, leading to muscle relaxation and bronchodilation that lasts up to 12 hours. The (S)-enantiomer is the active form of the drug, demonstrating greater efficacy and receptor specificity compared to its (R)-enantiomer. Salmeterol’s molecular design allows for sustained action, making it effective in maintaining prolonged airway openness and improving breathing in patients.
CAS Number | 135271-48-6 |
Molecular Formula | C25H37NO4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-(hydroxymethyl)-4-[(1S)-1-hydroxy-2-[6-(4-phenylbutoxy)hexylamino]ethyl]phenol |
InChI | InChI=1S/C25H37NO4/c27-20-23-18-22(13-14-24(23)28)25(29)19-26-15-7-1-2-8-16-30-17-9-6-12-21-10-4-3-5-11-21/h3-5,10-11,13-14,18,25-29H,1-2,6-9,12,15-17,19-20H2/t25-/m1/s1 |
InChIKey | GIIZNNXWQWCKIB-RUZDIDTESA-N |
SMILES | C1=CC=C(C=C1)CCCCOCCCCCCNCC(C2=CC(=C(C=C2)O)CO)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |