For research use only. Not for therapeutic Use.
S-(+)-Scoulerine(Cat No.:R050970)is a natural alkaloid found in several plant species, particularly those of the Papaveraceae family. It exhibits a variety of pharmacological properties, including antimicrobial, anti-inflammatory, and antioxidant effects. Scoulerine has been studied for its potential role in modulating neurotransmitter systems, making it a compound of interest in neurological research. Additionally, its ability to inhibit enzymes involved in cell signaling pathways highlights its potential in cancer research. S-(+)-Scoulerine is valuable for exploring new therapeutic approaches in treating infections, inflammation, and other disease-related conditions.
CAS Number | 6451-73-6 |
Synonyms | (S)-(+)-5,8,13,13a-Tetrahydro-3,10-dimethoxy-6H-dibenzo[a,g]quinolizine-2,9-diol; |
Molecular Formula | C₁₉H₂₁NO₄ |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | (13aS)-3,10-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-2,9-diol |
InChI | InChI=1S/C19H21NO4/c1-23-17-4-3-11-7-15-13-9-16(21)18(24-2)8-12(13)5-6-20(15)10-14(11)19(17)22/h3-4,8-9,15,21-22H,5-7,10H2,1-2H3/t15-/m0/s1 |
InChIKey | KNWVMRVOBAFFMH-HNNXBMFYSA-N |
SMILES | COC1=C(C2=C(C[C@H]3C4=CC(=C(C=C4CCN3C2)OC)O)C=C1)O |