Home
>
Chemical Reagents>Organic Building Blocks> (S)-tert-Butyl 6-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-2-aminohexanoate hydrochloride
For research use only. Not for therapeutic Use.
(S)-tert-Butyl 6-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-2-aminohexanoate hydrochloride(Cat No.:L006745), is a chiral compound used in chemical and pharmaceutical research. This compound consists of a tert-butyl ester group, an amino acid derivative, and a fluorenyl carbonyl-protecting group. Its specific stereochemistry and functional groups make it a valuable intermediate in the synthesis of peptides and peptidomimetics. Researchers use it to create complex molecules for studying biological processes and developing potential therapeutic agents.
CAS Number | 330795-57-8 |
Molecular Formula | C25H33ClN2O4 |
Purity | ≥95% |
IUPAC Name | tert-butyl (2S)-2-amino-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate;hydrochloride |
InChI | InChI=1S/C25H32N2O4.ClH/c1-25(2,3)31-23(28)22(26)14-8-9-15-27-24(29)30-16-21-19-12-6-4-10-17(19)18-11-5-7-13-20(18)21;/h4-7,10-13,21-22H,8-9,14-16,26H2,1-3H3,(H,27,29);1H/t22-;/m0./s1 |
InChIKey | ODVRYXVAUBMJLL-FTBISJDPSA-N |
SMILES | CC(C)(C)OC(=O)C(CCCCNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |