For research use only. Not for therapeutic Use.
s-Triaminotrinitrobenzene(Cat No.:R054184), is a chemical compound known for its explosive properties. It is commonly referred to as TATB and is used as an insensitive high explosive (IHE) in the defense and munitions industry. TATB is valued for its stability and insensitivity to shock, friction, and heat, making it a safer choice for handling and storage compared to more sensitive explosives.
Catalog Number | R054184 |
CAS Number | 3058-38-6 |
Synonyms | 1,3,5-Triamino-2,4,6-trinitrobenzene; sym-Triaminotrinitrobenzene; 2,4,6-Trinitro-1,3,5-benzenetriamine; EDC 35; NSC 243156; RX 03GO; TATB |
Molecular Formula | C6H6N6O6 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2,4,6-trinitrobenzene-1,3,5-triamine |
InChI | InChI=1S/C6H6N6O6/c7-1-4(10(13)14)2(8)6(12(17)18)3(9)5(1)11(15)16/h7-9H2 |
InChIKey | JDFUJAMTCCQARF-UHFFFAOYSA-N |
SMILES | C1(=C(C(=C(C(=C1[N+](=O)[O-])N)[N+](=O)[O-])N)[N+](=O)[O-])N |