For research use only. Not for therapeutic Use.
S-Trityl-L-cysteine(Cat No.:R004262) is a chemical compound utilized as a protecting group in peptide synthesis. Its action target involves the protection of the thiol group of L-cysteine during chemical reactions. The mode of action includes adding the trityl (triphenylmethyl) group to the thiol group of L-cysteine, shielding it from unwanted reactions, and enabling specific chemical transformations. Pharmacologically, S-Trityl-L-cysteine itself does not have direct medical applications. Instead, it serves as a valuable tool in organic synthesis, particularly in peptide chemistry, where the trityl protecting group is used to protect and manipulate the reactivity of thiol groups in peptides.
CAS Number | 2799-07-7 |
Synonyms | S-(Triphenylmethyl)-L-cysteine; (2R)-2-Amino-3-[(triphenylmethyl)thio]propanoic Acid; 3-Tritylthio-L-alanine; NSC 83265; S-Triphenylmethyl-L-cysteine; S-Trityl-(R)-cysteine; S-Tritylcysteine; Tritylthioalanine; |
Molecular Formula | C22H21NO2S |
Purity | ≥95% |
Target | Cytoskeleton |
Storage | -20°C |
IUPAC Name | (2R)-2-amino-3-tritylsulfanylpropanoic acid |
InChI | InChI=1S/C22H21NO2S/c23-20(21(24)25)16-26-22(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15,20H,16,23H2,(H,24,25)/t20-/m0/s1 |
InChIKey | DLMYFMLKORXJPO-FQEVSTJZSA-N |
SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)SCC(C(=O)O)N |