For research use only. Not for therapeutic Use.
(S)-VQW-765（Cat No.:I041403）is a selective inhibitor of a specific protein target, designed to modulate biological pathways in the treatment of diseases related to inflammation and immune response. As a chiral compound, the (S)-enantiomer of VQW-765 is preferred for its enhanced potency and specificity compared to its counterparts. It has shown promise in preclinical studies for its potential to treat conditions such as autoimmune diseases and certain cancers by blocking key enzymes or receptors involved in disease progression. Its development represents an advancement in precision therapeutics for targeted molecular interventions.
| Synonyms | (3S)-3-[6-(4-methylphenyl)pyridin-3-yl]oxy-1-azabicyclo[2.2.2]octane |
| Molecular Formula | C19H22N2O |
| Purity | ≥95% |
| IUPAC Name | (3S)-3-[6-(4-methylphenyl)pyridin-3-yl]oxy-1-azabicyclo[2.2.2]octane |
| InChI | InChI=1S/C19H22N2O/c1-14-2-4-15(5-3-14)18-7-6-17(12-20-18)22-19-13-21-10-8-16(19)9-11-21/h2-7,12,16,19H,8-11,13H2,1H3/t19-/m1/s1 |
| InChIKey | NPDLTEZXGWRMLQ-LJQANCHMSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC=C(C=C2)O[C@@H]3CN4CCC3CC4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
