For research use only. Not for therapeutic Use.
S-(-)-Warfarin(CAT: R013560) is one of the enantiomers of warfarin, a widely used anticoagulant medication. Warfarin exists as two enantiomers: S-(-)-warfarin and R-(+)-warfarin, with S-(-)-warfarin being the more potent of the two in terms of its anticoagulant effect. It works by inhibiting the enzyme vitamin K epoxide reductase, which is essential for the synthesis of clotting factors, thus reducing the blood’s ability to clot. Due to its potency, S-(-)-warfarin is primarily responsible for the drug’s therapeutic effects but also plays a significant role in potential side effects like bleeding. Close monitoring is required when patients are on warfarin therapy to ensure safety and efficacy.
CAS Number | 5543-57-7 |
Synonyms | 4-Hydroxy-3-[(1S)-3-oxo-1-phenylbutyl]-2H-1-benzopyran-2-one; S-(-)- ?3-(α-Acetonylbenzyl)-4-hydroxycoumarin; (-)-Warfarin; (S)-Warfarin; |
Molecular Formula | C19H16O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-hydroxy-3-[(1S)-3-oxo-1-phenylbutyl]chromen-2-one |
InChI | InChI=1S/C19H16O4/c1-12(20)11-15(13-7-3-2-4-8-13)17-18(21)14-9-5-6-10-16(14)23-19(17)22/h2-10,15,21H,11H2,1H3/t15-/m0/s1 |
InChIKey | PJVWKTKQMONHTI-HNNXBMFYSA-N |
SMILES | CC(=O)CC(C1=CC=CC=C1)C2=C(C3=CC=CC=C3OC2=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |