For research use only. Not for therapeutic Use.
S107 hydrochloride is a specific stabilizer of RyR2 (type 2 ryanodine receptor)/FKBP12.6 (FK506 binding protein 12.6) complex that affects Ca2+ signaling.
| Catalog Number | I047449 |
| CAS Number | 1357476-46-0 |
| Molecular Formula | C11H16ClNOS |
| Purity | ≥95% |
| Storage | 3 years -20°C powder |
| SMILES | CN1CCSC2=C(C1)C=C(C=C2)OC.Cl |
| Reference | [1] Lehnart SE, et al. J Clin Invest. 2008;118(6):2230-2245. |
