For research use only. Not for therapeutic Use.
S1R agonist 2 hydrochloride(CAT: I040827), also known as Compound 8b hydrochloride, is a selective sigma-1 receptor (S1R) agonist with high affinity, exhibiting Ki values of 1.1 nM for S1R and 88 nM for sigma-2 receptors (S2R). It demonstrates neuroprotective properties, effectively safeguarding neurons against reactive oxygen species (ROS) and N-methyl-D-aspartate (NMDA)-induced neurotoxicity. In vitro studies have shown that at concentrations ranging from 0.1 to 5 μM, S1R agonist 2 hydrochloride significantly enhances nerve growth factor (NGF)-induced neurite outgrowth in a dose-dependent manner. Additionally, at 1 μM, it markedly inhibits Rotenone-induced cellular damage in SHSY5Y cells over a 24-hour period. These findings suggest its potential utility in neurodegenerative disease research.
| Synonyms | 4-benzyl-1-(3-phenoxypropyl)piperidine;hydrochloride |
| Molecular Formula | C21H28ClNO |
| Purity | ≥95% |
| IUPAC Name | 4-benzyl-1-(3-phenoxypropyl)piperidine;hydrochloride |
| InChI | InChI=1S/C21H27NO.ClH/c1-3-8-19(9-4-1)18-20-12-15-22(16-13-20)14-7-17-23-21-10-5-2-6-11-21;/h1-6,8-11,20H,7,12-18H2;1H |
| InChIKey | NIEBKRGSJLBMBJ-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1CC2=CC=CC=C2)CCCOC3=CC=CC=C3.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
