For research use only. Not for therapeutic Use.
SA4503 dihydrochloride (Cat.No:I002163) is a chemical compound with potential neuroprotective and neuromodulatory effects. It acts as a selective sigma-1 receptor agonist, a protein involved in various cellular processes and neuroprotection. SA4503 dihydrochloride has been studied for its potential therapeutic applications in neurodegenerative disorders and as a candidate for drug development.
CAS Number | 165377-44-6 |
Synonyms | 1-(3,4-dimethoxyphenethyl)-4-(3-phenylpropyl)piperazine dihydrochloride |
Molecular Formula | C23H32N2O2.2HCl |
Purity | ≥95% |
Target | Sigma Receptor |
Solubility | DMSO < 10.4 mg/mL |
Storage | Store at RT |
IC50 | 17.4 nM [1] |
IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-4-(3-phenylpropyl)piperazine;dihydrochloride |
InChI | InChI=1S/C23H32N2O2.2ClH/c1-26-22-11-10-21(19-23(22)27-2)12-14-25-17-15-24(16-18-25)13-6-9-20-7-4-3-5-8-20;;/h3-5,7-8,10-11,19H,6,9,12-18H2,1-2H3;2*1H |
InChIKey | XWOXAKBQEMQMFH-UHFFFAOYSA-N |
SMILES | COC1=C(C=C(C=C1)CCN2CCN(CC2)CCCC3=CC=CC=C3)OC.Cl.Cl |
Reference | <p style=/line-height:25px/> |