For research use only. Not for therapeutic Use.
SABA1（Cat No.:I043709）is a selective small molecule compound designed to target and inhibit the S100A8/S100A9 complex, which plays a critical role in inflammatory responses and immune cell recruitment. This complex is involved in various diseases, including autoimmune disorders, chronic inflammation, and cancer. By inhibiting SABA1, the activity of S100A8/S100A9 is disrupted, leading to reduced inflammation and immune cell activation. SABA1 shows potential for therapeutic use in conditions such as rheumatoid arthritis, psoriasis, and inflammatory bowel disease, offering a novel approach to modulating inflammatory pathways and improving disease outcomes.
| CAS Number | 690681-65-3 |
| Synonyms | ethyl 4-[[2-chloro-5-(phenylcarbamoyl)phenyl]sulfonylamino]benzoate |
| Molecular Formula | C22H19ClN2O5S |
| Purity | ≥95% |
| IUPAC Name | ethyl 4-[[2-chloro-5-(phenylcarbamoyl)phenyl]sulfonylamino]benzoate |
| InChI | InChI=1S/C22H19ClN2O5S/c1-2-30-22(27)15-8-11-18(12-9-15)25-31(28,29)20-14-16(10-13-19(20)23)21(26)24-17-6-4-3-5-7-17/h3-14,25H,2H2,1H3,(H,24,26) |
| InChIKey | LCDQWAPYDBBYCH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)NS(=O)(=O)C2=C(C=CC(=C2)C(=O)NC3=CC=CC=C3)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
