For research use only. Not for therapeutic Use.
Sabinene(Cat No.:M012881) is a natural monocyclic terpene with a bicyclic structure, found in various essential oils including oak trees, tea tree, black pepper, and nutmeg. Its molecular formula is C10H16, and it is known for its distinctive spicy, woody aroma. Sabinene is commonly used in the flavoring and fragrance industries to impart a fresh, peppery scent and taste to products. Additionally, it possesses anti-inflammatory and antimicrobial properties, making it valuable in medicinal and therapeutic applications. Its presence in multiple plants contributes to their characteristic flavors and potential health benefits.
CAS Number | 3387-41-5 |
Synonyms | 1-Isopropyl-4-methylenebicyclo[3.1.0]hexane;1-isopropyl-4-methylenebicyclo[3.1.0]hexane (sabinene);4(10)-Thujene;4-methylene-1-(1-methylethyl)bicyclo[3.1.0]hexane;4-methylene-1-(1-methylethyl)-bicyclo[3.1.0]hexane;4-thujene;bicyclo[3.1.0]hexane,4-met |
Molecular Formula | C10H16 |
Purity | ≥95% |
Target | Disease Research Fields |
Storage | -20°C |
IUPAC Name | 4-methylidene-1-propan-2-ylbicyclo[3.1.0]hexane |
InChI | InChI=1S/C10H16/c1-7(2)10-5-4-8(3)9(10)6-10/h7,9H,3-6H2,1-2H3 |
InChIKey | NDVASEGYNIMXJL-UHFFFAOYSA-N |
SMILES | CC(C)C12CCC(=C)C1C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |