For research use only. Not for therapeutic Use.
Sabutoclax(Cat No.: R061522) is a small molecule inhibitor that targets the Bcl-2 family of proteins, which play a crucial role in regulating apoptosis (programmed cell death). By inhibiting anti-apoptotic proteins such as Bcl-2 and Bcl-xL, sabutoclax promotes cell death in cancer cells, particularly in hematological malignancies like leukemia and lymphoma. It has shown promise in preclinical studies as a potential therapeutic agent for overcoming resistance to conventional chemotherapy. Research is ongoing to determine its efficacy and safety in clinical settings.
| CAS Number | 1228108-65-3 |
| Synonyms | BI 97C1; (1R)-1,1’,6,6’,7,7’-Hexahydroxy-3,3’-dimethyl-N5,N5’-bis[(2R)-2-phenylpropyl]-[2,2’-binaphthalene]-5,5’-dicarboxamide |
| Molecular Formula | C42H40N2O8 |
| Purity | ≥95% |
| Target | Bcl-2 Family |
| Solubility | Soluble in DMSO > 10 mM |
| Storage | 3 years -20C powder |
| IUPAC Name | 2,3,5-trihydroxy-7-methyl-N-[(2R)-2-phenylpropyl]-6-[1,6,7-trihydroxy-3-methyl-5-[[(2R)-2-phenylpropyl]carbamoyl]naphthalen-2-yl]naphthalene-1-carboxamide |
| InChI | InChI=1S/C42H40N2O8/c1-21-15-27-29(17-31(45)39(49)35(27)41(51)43-19-23(3)25-11-7-5-8-12-25)37(47)33(21)34-22(2)16-28-30(38(34)48)18-32(46)40(50)36(28)42(52)44-20-24(4)26-13-9-6-10-14-26/h5-18,23-24,45-50H,19-20H2,1-4H3,(H,43,51)(H,44,52)/t23-,24-/m0/s1 |
| InChIKey | RAYNZUHYMMLQQA-ZEQRLZLVSA-N |
| SMILES | CC1=C(C(=C2C=C(C(=C(C2=C1)C(=O)NCC(C)C3=CC=CC=C3)O)O)O)C4=C(C=C5C(=C4O)C=C(C(=C5C(=O)NCC(C)C6=CC=CC=C6)O)O)C |
