For research use only. Not for therapeutic Use.
SAG-d3(Cat No.:S000289) is a deuterated version of SAG (Smoothened Agonist), where three hydrogen atoms are replaced with deuterium, enhancing its molecular stability and making it valuable as an internal standard for analytical methods such as mass spectrometry and NMR spectroscopy. SAG is a small molecule that activates the Hedgehog signaling pathway, which is critical in developmental processes and is implicated in various cancers. By incorporating deuterium, SAG-d3 provides a tool for more precise pharmacokinetic and pharmacodynamic studies, allowing researchers to better understand the compound’s behavior and effects within biological systems.
Molecular Formula | C28H25D3ClN3OS |
Purity | ≥95% |
Target | Smo |
IUPAC Name | 3-chloro-N-[(3-pyridin-4-ylphenyl)methyl]-N-[4-(trideuteriomethylamino)cyclohexyl]-1-benzothiophene-2-carboxamide |
InChI | InChI=1S/C28H28ClN3OS/c1-30-22-9-11-23(12-10-22)32(28(33)27-26(29)24-7-2-3-8-25(24)34-27)18-19-5-4-6-21(17-19)20-13-15-31-16-14-20/h2-8,13-17,22-23,30H,9-12,18H2,1H3/i1D3 |
InChIKey | VFSUUTYAEQOIMW-FIBGUPNXSA-N |
SMILES | CNC1CCC(CC1)N(CC2=CC(=CC=C2)C3=CC=NC=C3)C(=O)C4=C(C5=CC=CC=C5S4)Cl |