For research use only. Not for therapeutic Use.
SAG Dihydrochloride (Cat No.:I012245) is a chemical compound often used in biochemical research, particularly in the study of signaling pathways involving the Hedgehog (Hh) pathway. It functions as an inhibitor of the Smoothened (Smo) protein, a key component in this signaling cascade. By blocking Smo, SAG Dihydrochloride can modulate the activity of Hh signaling, which is involved in various developmental processes and diseases, including cancer. SAG Dihydrochloride is typically used in cell culture experiments to investigate the molecular mechanisms of Hh-related diseases and to explore potential therapeutic strategies.
Catalog Number | I012245 |
CAS Number | 364590-63-6 |
Synonyms | 3-Chloro-benzo[b]thiophene-2-carboxylic acid (4-methylamino-cyclohexyl)-(3-pyridin-4-yl-benzyl)-amide Hydrochloride hydrate |
Molecular Formula | C28H32Cl3N3O2S |
Purity | ≥95% |
IUPAC Name | 3-chloro-N-[4-(methylamino)cyclohexyl]-N-[(3-pyridin-4-ylphenyl)methyl]-1-benzothiophene-2-carboxamide;hydrate;dihydrochloride |
InChI | InChI=1S/C28H28ClN3OS.2ClH.H2O/c1-30-22-9-11-23(12-10-22)32(28(33)27-26(29)24-7-2-3-8-25(24)34-27)18-19-5-4-6-21(17-19)20-13-15-31-16-14-20;;;/h2-8,13-17,22-23,30H,9-12,18H2,1H3;2*1H;1H2 |
InChIKey | IYXUQUYRWPGIQL-UHFFFAOYSA-N |
SMILES | CNC1CCC(CC1)N(CC2=CC(=CC=C2)C3=CC=NC=C3)C(=O)C4=C(C5=CC=CC=C5S4)Cl.O.Cl.Cl |