For research use only. Not for therapeutic Use.
SAHA (Cat No.:A000479), also known as Vorinostat, is a histone deacetylase (HDAC) inhibitor approved for treating cutaneous T-cell lymphoma. By inhibiting HDACs, SAHA promotes the acetylation of histones and non-histone proteins, leading to changes in gene expression that can induce cell cycle arrest, differentiation, and apoptosis in cancer cells. Its broad-spectrum activity against various cancer types makes it a valuable tool in oncology. Ongoing research is exploring its efficacy in combination therapies and its potential applications in other malignancies, highlighting its role in epigenetic cancer treatments.
CAS Number | 149647-78-9 |
Synonyms | 149647-78-9; SAHA; Suberoylanilide hydroxamic acid; Zolinza; N-hydroxy-N/’-phenyloctanediamide |
Molecular Formula | C₁₄H₂₀N₂O₃ |
Purity | ≥95% |
Target | Epigenetics |
Solubility | >4.4mg/mL in DMSO |
Storage | -20°C |
IUPAC Name | N'-hydroxy-N-phenyloctanediamide |
InChI | InChI=1S/C14H20N2O3/c17-13(15-12-8-4-3-5-9-12)10-6-1-2-7-11-14(18)16-19/h3-5,8-9,19H,1-2,6-7,10-11H2,(H,15,17)(H,16,18) |
InChIKey | WAEXFXRVDQXREF-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)NC(=O)CCCCCCC(=O)NO |
Reference | 1: Bernhart E, Stuendl N, Kaltenegger H, Windpassinger C, Donohue N, Leithner A, 2: Kwak TW, Lee HL, Song YH, Kim C, Kim J, Seo SJ, Jeong YI, Kang DH. 3: Masadeh MM, Alzoubi KH, Al-Azzam SI, Al-Buhairan AM. Possible involvement of 4: Nanavati C, Ruszaj D, Mager DE. Cell Signaling Model Connects Vorinostat 5: Holtan SG, Weisdorf DJ. Vorinostat is victorious in GVHD prevention. Blood. 6: Galanis E, Anderson SK, Miller CR, Sarkaria JN, Jaeckle K, Buckner JC, Ligon 7: Moj D, Britz H, Burhenne J, Stewart CF, Egerer G, Haefeli WE, Lehr T. A <br> 9: Luu T, Kim KP, Blanchard S, Anyang B, Hurria A, Yang L, Beumer JH, Somlo G, 10: Takeuchi S, Yoshimura K, Fujiwara T, Ando M, Shimizu S, Nagase K, Hasegawa Y, |