For research use only. Not for therapeutic Use.
Sakuranetin（Cat No.:R029133）is a flavonoid with notable anti-inflammatory, antioxidant, and anticancer properties. Found naturally in various plants, particularly in citrus fruits, it has been studied for its potential to modulate multiple biochemical pathways involved in inflammation and cell growth. Sakuranetin exhibits strong free radical scavenging activity, which contributes to its protective effects against oxidative stress. Research also suggests it may offer therapeutic benefits in diseases like cancer, cardiovascular conditions, and neurodegenerative disorders. As a promising natural compound, sakuranetin is gaining attention for its broad biological activity and potential for drug development.
| Catalog Number | R029133 |
| CAS Number | 2957-21-3 |
| Molecular Formula | C16H14O5 |
| Purity | ≥95% |
| Target | Fungal |
| IUPAC Name | (2S)-5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-2,3-dihydrochromen-4-one |
| InChI | InChI=1S/C16H14O5/c1-20-11-6-12(18)16-13(19)8-14(21-15(16)7-11)9-2-4-10(17)5-3-9/h2-7,14,17-18H,8H2,1H3/t14-/m0/s1 |
| InChIKey | DJOJDHGQRNZXQQ-AWEZNQCLSA-N |
| SMILES | COC1=CC(=C2C(=O)C[C@H](OC2=C1)C3=CC=C(C=C3)O)O |
