For research use only. Not for therapeutic Use.
Salbutamol Sulfate（Cat No.:A000418）is a bronchodilator widely used to treat respiratory conditions such as asthma and chronic obstructive pulmonary disease (COPD). It works by stimulating beta-2 adrenergic receptors in the lungs, causing smooth muscle relaxation and airway dilation. This leads to easier breathing and rapid relief from symptoms like wheezing and shortness of breath. Salbutamol Sulfate is available in various formulations, including inhalers and nebulizers, making it a key treatment for managing acute bronchospasm and providing long-term asthma control in clinical settings.
| Catalog Number | A000418 |
| CAS Number | 51022-70-9 |
| Synonyms | Albuterol |
| Molecular Formula | C13H21NO3.H2SO4 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | Limited solubility |
| Storage | 3 years -20C powder |
| IUPAC Name | 4-[2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenol;sulfuric acid |
| InChI | InChI=1S/2C13H21NO3.H2O4S/c2*1-13(2,3)14-7-12(17)9-4-5-11(16)10(6-9)8-15;1-5(2,3)4/h2*4-6,12,14-17H,7-8H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | BNPSSFBOAGDEEL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(C1=CC(=C(C=C1)O)CO)O.CC(C)(C)NCC(C1=CC(=C(C=C1)O)CO)O.OS(=O)(=O)O |
