For research use only. Not for therapeutic Use.
Salicylanilide（Cat No.:A000711）is an organic compound derived from salicylic acid and aniline, notable for its antimicrobial and antifungal properties. Used primarily in dermatology, it serves as an active ingredient in topical treatments targeting fungal infections, including those caused by dermatophytes. Its mechanism involves disrupting microbial cell membrane integrity, leading to cell death. Beyond its use in skincare, Salicylanilide is also studied for potential anti-parasitic effects, particularly against helminths in veterinary applications. Its structural versatility has made it a valuable compound in medicinal chemistry and pharmacological research.
| Catalog Number | A000711 |
| CAS Number | 87-17-2 |
| Synonyms | WR10019 |
| Molecular Formula | C13H11NO2 |
| Purity | ≥95% |
| Target | Anti-infection |
| Storage | -20°C |
| IUPAC Name | 2-hydroxy-N-phenylbenzamide |
| InChI | InChI=1S/C13H11NO2/c15-12-9-5-4-8-11(12)13(16)14-10-6-2-1-3-7-10/h1-9,15H,(H,14,16) |
| InChIKey | WKEDVNSFRWHDNR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C2=CC=CC=C2O |
