For research use only. Not for therapeutic Use.
Salicylic Acid-d4 is a deuterium-labeled version of salicylic acid, a well-known compound with keratolytic, comedolytic, and anti-inflammatory properties. It functions by promoting the shedding of the outer layer of skin cells and reducing inflammation. In pharmaceutical chemistry, it is used in the formulation of topical treatments for acne, psoriasis, and other skin conditions. The deuterium labeling facilitates its use as an internal standard in mass spectrometry, enabling accurate quantification in pharmacokinetic and metabolic studies. Additionally, it is employed in organic chemistry for synthetic research and as a reference standard in analytical chemistry, ensuring precise and reliable measurement in various applications.
CAS Number | 78646-17-0 |
Synonyms | 2-Hydroxybenzoic Acid-d4; 2-Carboxyphenol-d4; 2-Hydroxybenzenecarboxylic Acid-d4; 2-Hydroxybenzoic Acid-d4; o-Carboxyphenol-d4; o-Hydroxybenzoic Acid-d4; Rutranex-d4; Saligel-d4; Salonil-d4; Salvona Nanosal-d4; Stri-Dex-d4; Trans-Ver-Sal-d4; Verrugon |
Molecular Formula | C7H6O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2,3,4,5-tetradeuterio-6-hydroxybenzoic acid |
InChI | InChI=1S/C7H6O3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H,(H,9,10)/i1D,2D,3D,4D |
InChIKey | YGSDEFSMJLZEOE-RHQRLBAQSA-N |
SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)O)[2H])[2H] |