For research use only. Not for therapeutic Use.
Salvianolic acid B (Cat No.:I000808) is a bioactive compound found in Salvia miltiorrhiza (Danshen), a traditional Chinese herb known for its cardiovascular benefits. It is a potent antioxidant and has anti-inflammatory, anti-fibrotic, and neuroprotective effects. Salvianolic acid B is often studied for its potential to improve blood circulation, protect against oxidative stress, and reduce the risk of cardiovascular diseases like atherosclerosis and heart failure. Additionally, it shows promise in mitigating neurodegenerative diseases and protecting liver function. Further research is ongoing to explore its therapeutic applications.
CAS Number | 121521-90-2 |
Synonyms | Lithospermate B |
Molecular Formula | C36H30O16 |
Purity | ≥95% |
Target | Autophagy |
Solubility | 20 mg/mL in DMSO |
Storage | -20°C |
IUPAC Name | (2R)-2-[(E)-3-[(2S,3S)-3-[(1R)-1-carboxy-2-(3,4-dihydroxyphenyl)ethoxy]carbonyl-2-(3,4-dihydroxyphenyl)-7-hydroxy-2,3-dihydro-1-benzofuran-4-yl]prop-2-enoyl]oxy-3-(3,4-dihydroxyphenyl)propanoic acid |
InChI | InChI=1S/C36H30O16/c37-20-6-1-16(11-24(20)41)13-27(34(45)46)50-29(44)10-5-18-3-9-23(40)33-30(18)31(32(52-33)19-4-8-22(39)26(43)15-19)36(49)51-28(35(47)48)14-17-2-7-21(38)25(42)12-17/h1-12,15,27-28,31-32,37-43H,13-14H2,(H,45,46)(H,47,48)/b10-5+/t27-,28-,31+,32-/m1/s1 |
InChIKey | SNKFFCBZYFGCQN-VWUOOIFGSA-N |
SMILES | C1=CC(=C(C=C1C[C@H](C(=O)O)OC(=O)/C=C/C2=C3[C@@H]([C@H](OC3=C(C=C2)O)C4=CC(=C(C=C4)O)O)C(=O)O[C@H](CC5=CC(=C(C=C5)O)O)C(=O)O)O)O |