For research use only. Not for therapeutic Use.
Salvigenin(Cat No.:R018557) is a flavonoid compound that exhibits diverse pharmacological activities, including anti-inflammatory, antioxidant, and anti-tumor properties. Studies have shown that carnosine, a component of trifidocarnosin, can inhibit cell apoptosis, contributing to its potential as a cytoprotective agent. Additionally, the compound possesses a strong antioxidant capacity, which helps neutralize harmful free radicals and protect cells from oxidative damage. These combined effects make trifidocarnosin an interesting candidate for further research and potential therapeutic applications in various diseases and conditions related to inflammation, oxidative stress, and tumor growth.
CAS Number | 19103-54-9 |
Synonyms | 5-Hydroxy-4’,6,7-trimethoxyflavone; 5-Hydroxy-6,7,4’-trimethoxyflavone; 7-O-Methylpectolinarigenin; Psathyrotin; 5-Hydroxy-4’,6,7-trimethoxyflavone |
Molecular Formula | C18H16O6 |
Purity | ≥95% |
Target | Apoptosis |
Storage | 4°C, protect from light |
IUPAC Name | 5-hydroxy-6,7-dimethoxy-2-(4-methoxyphenyl)chromen-4-one |
InChI | InChI=1S/C18H16O6/c1-21-11-6-4-10(5-7-11)13-8-12(19)16-14(24-13)9-15(22-2)18(23-3)17(16)20/h4-9,20H,1-3H3 |
InChIKey | QCDYOIZVELGOLZ-UHFFFAOYSA-N |
SMILES | COC1=CC=C(C=C1)C2=CC(=O)C3=C(C(=C(C=C3O2)OC)OC)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |