For research use only. Not for therapeutic Use.
Salvinorin A is a potent psychoactive compound and the primary active constituent of the plant Salvia divinorum. It is a unique diterpenoid known for its ability to produce intense, short-lived hallucinations. Unlike most other hallucinogens, Salvinorin A is not an alkaloid and acts as a potent agonist of the kappa-opioid receptor (KOR), which is associated with its dissociative effects. It is of interest in both neuroscience and psychopharmacology for its unusual mechanism of action and potential therapeutic applications, such as in the treatment of mood disorders and addiction.
| Catalog Number | I010510 |
| CAS Number | 83729-01-5 |
| Synonyms | Alternative Name: Divinorin A |
| Molecular Formula | C23H28O8 |
| Purity | ≥95% |
| Target | Opioid Receptor |
| Solubility | Soluble to 10 mM in ethanol |
| Storage | Desiccate at -20C |
| IUPAC Name | methyl (2S,4aR,6aR,7R,9S,10aS,10bR)-9-acetyloxy-2-(furan-3-yl)-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate |
| InChI | InChI=1S/C23H28O8/c1-12(24)30-16-9-15(20(26)28-4)22(2)7-5-14-21(27)31-17(13-6-8-29-11-13)10-23(14,3)19(22)18(16)25/h6,8,11,14-17,19H,5,7,9-10H2,1-4H3/t14-,15-,16-,17-,19-,22-,23-/m0/s1 |
| InChIKey | OBSYBRPAKCASQB-AGQYDFLVSA-N |
| SMILES | CC(=O)OC1CC(C2(CCC3C(=O)OC(CC3(C2C1=O)C)C4=COC=C4)C)C(=O)OC |
