For research use only. Not for therapeutic Use.
Salvinorin A is a hallucinogenic derived from the <em>S. divinorum</em> plant used in traditional spiritual practices of the Mazatec Indians and now gaining popularity as a recreational drug. Unlike other hallucinogens, which mediate their effects through serotonin 5-<wbr></wbr>HT<sub>2A</sub> receptors, salvinorin A is a potent, selective κ opioid receptor agonist (K<sub>i</sub> = 2.4 nM; EC<sub>50</sub> = 1.8 nM). Salvinorin B is the major deacetylated metabolite of salvinorin A and reportedly lacks pharmacological activity. Alkoxymethyl ether derivatives of salvinorin B have been designed in an effort to develop selective antagonists or partial agonists of κ-opioid receptors with potential utility in the treatment of depression or mania and the general study of κ opioid receptor signaling.
| Catalog Number | R057296 |
| CAS Number | 92545-30-7 |
| Synonyms | (2S,4aR,6aR,7R,9S,10aS,10bR)-2-(3-Furanyl)dodecahydro-9-hydroxy-6a,10b-dimethyl-4,10-dioxo-2H-naphtho[2,1-c]pyran-7-carboxylic Acid Methyl Ester; ?[2S-(2α,4aα,6aβ,7β,9β,10aα,10bβ)]-2-(3-Furanyl)dodecahydro-9-hydroxy-6a,10b-dimethyl-4,10-dioxo-2H-nap |
| Molecular Formula | C21H26O7 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | methyl (2S,4aR,6aR,7R,9S,10aS,10bR)-2-(furan-3-yl)-9-hydroxy-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate |
| InChI | InChI=1S/C21H26O7/c1-20-6-4-12-19(25)28-15(11-5-7-27-10-11)9-21(12,2)17(20)16(23)14(22)8-13(20)18(24)26-3/h5,7,10,12-15,17,22H,4,6,8-9H2,1-3H3/t12-,13-,14-,15-,17-,20-,21-/m0/s1 |
| InChIKey | BLTMVAIOAAGYAR-CEFSSPBYSA-N |
| SMILES | CC12CCC3C(=O)OC(CC3(C1C(=O)C(CC2C(=O)OC)O)C)C4=COC=C4 |
