For research use only. Not for therapeutic Use.
Salviolone（Cat No.:M024482）is a natural compound found in the essential oils of certain plants, particularly those in the Salvia genus, such as Salvia officinalis (sage). It has shown potential antioxidant, anti-inflammatory, and antimicrobial properties, making it of interest for therapeutic use in conditions related to oxidative stress, inflammation, and infection. Research is ongoing to explore its neuroprotective effects, particularly in neurodegenerative diseases such as Alzheimer’s. Salviolone’s ability to modulate cellular pathways may provide a basis for its use in developing treatments for various health conditions, including inflammatory and cognitive disorders.
| CAS Number | 119400-86-1 |
| Synonyms | 9-hydroxy-4,4,8-trimethyl-2,3-dihydro-1H-cyclohepta[a]naphthalen-10-one |
| Molecular Formula | C18H20O2 |
| Purity | ≥95% |
| IUPAC Name | 9-hydroxy-4,4,8-trimethyl-2,3-dihydro-1H-cyclohepta[a]naphthalen-10-one |
| InChI | InChI=1S/C18H20O2/c1-11-9-12-6-7-15-13(5-4-8-18(15,2)3)14(12)10-16(19)17(11)20/h6-7,9-10H,4-5,8H2,1-3H3,(H,19,20) |
| InChIKey | QATRODNHXVHGNU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)C=C2C3=C(C=CC2=C1)C(CCC3)(C)C)O |
