For research use only. Not for therapeutic Use.
Sanguinarine (Cat.No:I002823) is a naturally occurring alkaloid derived from plants such as Sanguinaria canadensis. Known for its broad-spectrum bioactivity, sanguinarine exhibits potent anticancer, antimicrobial, and anti-inflammatory properties. It induces apoptosis in cancer cells by targeting multiple signaling pathways and oxidative stress mechanisms. Additionally, it inhibits bacterial and fungal growth, making it valuable in antimicrobial research. Sanguinarine’s ability to modulate inflammation further highlights its therapeutic potential, positioning it as a critical compound in studies of oncology, infectious diseases, and inflammation.
Catalog Number | I002823 |
CAS Number | 2447-54-3 |
Molecular Formula | C20H14NO4+ |
Purity | ≥95% |
Target | Autophagy |
Storage | Store at -20℃ |
IUPAC Name | 24-methyl-5,7,18,20-tetraoxa-24-azoniahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(24),2,4(8),9,11,13,15,17(21),22-nonaene |
InChI | InChI=1S/C20H14NO4/c1-21-8-15-12(4-5-16-20(15)25-10-22-16)13-3-2-11-6-17-18(24-9-23-17)7-14(11)19(13)21/h2-8H,9-10H2,1H3/q+1 |
InChIKey | INVGWHRKADIJHF-UHFFFAOYSA-N |
SMILES | C[N+]1=C2C(=C3C=CC4=C(C3=C1)OCO4)C=CC5=CC6=C(C=C52)OCO6 |