For research use only. Not for therapeutic Use.
(-)-Santonin（Cat No.:R025528）, is a naturally occurring sesquiterpene lactone found in Artemisia maritima plants. Traditionally used as an anthelmintic, it has been employed for expelling intestinal worms. (-)-Santonin exhibits antiparasitic activity by paralyzing and eliminating worms. However, its use has declined in modern medicine due to more effective and safer alternatives.
| Catalog Number | R025528 |
| CAS Number | 481-06-1 |
| Synonyms | (-)-α-Santonin; 1,2,3,4,4a,7-Hexahydro-1-hydroxy-α,4a,8-trimethyl-7-oxo-2-naphthaleneacetic Acid; γ-lactone; NSC 4900; Santonin; Semenen; alpha-Santonin; α-Santonin; (11S)-6α-Hydroxy-3-oxoeudesma-1,4-dien-12-oic Acid γ-Lactone;?[3S-(3α,3aα,5aβ,9bβ)]- |
| Molecular Formula | C15H18O3 |
| Purity | ≥95% |
| Storage | 2-8°C |
| IUPAC Name | (3S,3aS,5aS,9bS)-3,5a,9-trimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2,8-dione |
| InChI | InChI=1S/C15H18O3/c1-8-10-4-6-15(3)7-5-11(16)9(2)12(15)13(10)18-14(8)17/h5,7-8,10,13H,4,6H2,1-3H3/t8-,10-,13-,15-/m0/s1 |
| InChIKey | XJHDMGJURBVLLE-BOCCBSBMSA-N |
| SMILES | CC1C2CCC3(C=CC(=O)C(=C3C2OC1=O)C)C |
